Current location

narf Source control manager Git

blob: c6b5a2866f9423cc7c3bf96801aa17bf6f1a575c (plain)

export PATH



SCRIPTS_TO_INSTALL="check kernel release usage usage_root hwinfo hwinfo_root hddinfo smart raid listen_ports"



if [ "$SCREENDIR" != "" ]; then SCREEN="$SCREENDIR -d -m"; fi

# add user ovh and group ovh to run rtm on it:
if [ -z "`pw usershow ovh 2>\/dev\/null`" ]; then
  pw useradd ovh -d /nonexistent -c "OVH user for RTM running" -s /usr/bin/false -P no

OVHUID=`pw usershow ovh | cut -d: -f3`
OVHGID=`pw usershow ovh | cut -d: -f4`

# Generate file
generate_update_report() {
    echo "Generating"
    cat << EOF > $RTM_REPORT
#! /usr/local/bin/perl

\$ENV{"LC_ALL"} = "POSIX";

    cat <<'EOF' >> $RTM_REPORT

use strict;
use Socket;

    echo "my \$destination_ip = '$ip';" >> $RTM_REPORT
    cat <<'EOF' >> $RTM_REPORT
my $message = <>;
exit if ($message eq '');


sub send_info {
    my $message = shift;
    $message = "rtm dINFO_RTM_update|$message\n";
    my $port = 6100 + int(rand(100));
    my $ok = eval {
        local $SIG{ALRM} = sub { print "rtm timeout\n"; die; };

        my $proto = getprotobyname('udp');
        socket(Socket_Handle, PF_INET, SOCK_DGRAM, $proto);
        my $iaddr = gethostbyname($destination_ip);
        my $sin = sockaddr_in("$port", $iaddr);
        send(Socket_Handle, "$message", 10, $sin);
        print "$message";
    if (!defined($ok)) {
        warn "error: $@\n";
    chown 0:0 "$RTM_REPORT"
    chmod 750 "$RTM_REPORT"

# check if script dirs point to reasonable paths
    if ! echo "$scr" | grep -q '^/usr/local/'; then
        echo "invalid script directory: $scr" >&2
        exit 1
# Remove old scripts dirs so there are no unwanted scripts hanging
# around

if [ ! -e "$DIR" ]; then mkdir -p $DIR; fi
if [ ! -e "$DIR_SCRIPTS_DAILY" ]; then mkdir -p "$DIR_SCRIPTS_DAILY"; fi
if [ ! -e "$DIR_SCRIPTS_MIN" ]; then mkdir -p "$DIR_SCRIPTS_MIN"; fi
if [ ! -e "$DIR_SCRIPTS_HOUR" ]; then mkdir -p "$DIR_SCRIPTS_HOUR"; fi
if [ ! -e "$DIR/bin" ]; then mkdir -p "$DIR/bin"; fi
if [ ! -e "$DIR/etc" ]; then mkdir -p "$DIR/etc"; fi

get_interface_ip() {
    ifconfig $iface 2>\/dev\/null | grep "inet.*netmask" | awk '{print $2}' | egrep '[0-9]+(\.[0-9]+){3}'

mainif="$(netstat -rn|grep "^default" | awk '{print $NF}'|sort|uniq|head -n1)"
mainip="$(get_interface_ip $mainif)"

arpa=`echo "$mainip" | sed "s/\./ /g" | awk '{print $3"."$2"."$1}'`;
ip=`host -t A mrtg.$ $DNSSERVER 2>/dev/null | grep "has address" | awk '{print $4}' | egrep '[0-9]+(\.[0-9]+){3}'`

if [ -z "$ip" ]; then
  echo "No IP from OVH network !"
  exit 1;
echo $ip > "$DIR/etc/rtm-ip"

cd `dirname $0`

if [ "$upgrade" != "-u" ]; then

if [ -z "`which bzip2`" ]; then
  echo "bzip2 not found!!"
  echo "Please install bzip2."

# Generate /scripts/min/ file
generate_check() {
    echo "Generating $DIR_SCRIPTS_MIN/"
    cat << EOF > $DIR_SCRIPTS_MIN/
#! /usr/local/bin/perl

\$ENV{"LC_ALL"} = "POSIX";

    cat <<'EOF' >> $DIR_SCRIPTS_MIN/
use strict;

# nothing here at the moment
    chown 0:0 "$DIR_SCRIPTS_MIN/"
    chmod 750 "$DIR_SCRIPTS_MIN/"

# Generate /scripts/day/ file
generate_kernel() {
    echo "Generating $DIR_SCRIPTS_DAILY/"
    cat << EOF > $DIR_SCRIPTS_DAILY/
#! /bin/sh


    cat <<'EOF' >> $DIR_SCRIPTS_DAILY/
# This script determines running kernel version.

rel=`uname -r`
ver=`uname -v`

if [ ! -z "$ver" ]; then
    echo "dINFO_KERNEL_release|$rel";
    echo "dINFO_KERNEL_version|$ver"
    chmod 750 "$DIR_SCRIPTS_DAILY/"

# Generate /scripts/day/ file
generate_release() {
    echo "Generating $DIR_SCRIPTS_DAILY/"
    cat << EOF > $DIR_SCRIPTS_DAILY/
#! /bin/sh


    cat <<'EOF' >> $DIR_SCRIPTS_DAILY/
# The script below is used to determine OS release.

distro=`uname -sr`
test -f /etc/ovhrelease && release_ovh=`cat /etc/ovhrelease`

echo "dINFO_RELEASE_os|$distro";
echo "dINFO_RELEASE_ovh|$release_ovh";
    chmod 750 "$DIR_SCRIPTS_DAILY/"

# Generate /scripts/hour/ file
generate_raid() {
    echo "Generating $DIR_SCRIPTS_HOUR/"
    cat << EOF > $DIR_SCRIPTS_HOUR/
#! /usr/local/bin/perl

\$ENV{"LC_ALL"} = "POSIX";

    cat <<'EOF' >> $DIR_SCRIPTS_HOUR/
# Shows information about RAID arrays such as disks capacity, models, overal array status.

use strict;
use IO::Select;

chomp(my @sysctl = `\/sbin\/sysctl dev 2>\/dev\/null`);

# TODO: Soft RAID with:
#   - gvinum and raid-5
# TODO: Mylex RAID support (no tools found. Only megarc/amrstat but not working for all cards)

# gmirror/gstripe:
chomp(my @gmirror = `gmirror status -s 2>\/dev\/null`);
chomp(my @gstripe = `gstripe status -s 2>\/dev\/null`);
if($#gmirror != -1 or $#gstripe != -1){
  my %raid;

  # gmirror/gstripe enabled
  foreach(@gmirror, @gstripe){
    # mirror/home  DEGRADED  da0s1f (65%)
    next unless $_ =~  m/^\s*(mirror|stripe)\/(\S+)\s+(\S+)\s+(.*?)(?:\s+\((\d+)%\))?\s*$/;
    $raid{$1}{$2}{state} = $3;
    my %tmp = (name=>$4);
    $tmp{syncpercent} = $5 if $5;
    push @{$raid{$1}{$2}{disks}}, \%tmp;

  foreach my $type (keys %raid){
    foreach my $vol (keys %{$raid{$type}}){
      my @data;
      if($type eq 'mirror'){
        chomp(@data = `gmirror list $vol 2>\/dev\/null`); 
        print "hHW_SCSIRAID_UNIT_$type\_vol-$vol\_type|MIRROR\n";
      }elsif($type eq 'stripe'){
        chomp(@data = `gstripe list $vol 2>\/dev\/null`); 
        print "hHW_SCSIRAID_UNIT_$type\_vol-$vol\_type|STRIPE\n";

      # volume info:
        last if /Consumers/i;

        print "hHW_SCSIRAID_UNIT_$type\_vol-$vol\_capacity|$1 $2\n"
          if /Mediasize:\s+\d+\s+\((\d+)(\w+)\)$/i;

        print "hHW_SCSIRAID_UNIT_$type\_vol-$vol\_phys|$1\n"
          if /Components:\s+(\d+)$/i;

          my $st = $1;
          $st eq 'COMPLETE' and $st = 'OK';
          print "hHW_SCSIRAID_UNIT_$type\_vol-$vol\_status|$st\n"

        print "hHW_SCSIRAID_UNIT_$type\_vol-$vol\_flags|$1\n"
          if /Flags:\s*(\w+)$/;

      # disk info:
      my ($ldn, $ldi); # lastDiskName and lastDiskId
      my $consumers = 0;

        # skip volume info:
        $consumers = 1 if /Consumers/i;
        next unless $consumers;

        ($ldi, $ldn) = ($1-1, $2)
          if /^(\d+)\.\s*Name:\s*(\S+)$/;
        print "hHW_SCSIRAID_PORT_$type\_vol-$vol\_phy$ldi\_capacity|$1 $2\n"
          if /Mediasize:\s+\d+\s+\((\d+)(\w+)\)$/i;

        print "hHW_SCSIRAID_PORT_$type\_vol-$vol\_phy$ldi\_status|$1\n"
          if /State:\s*(\w+)$/;
        print "hHW_SCSIRAID_PORT_$type\_vol-$vol\_phy$ldi\_flags|$1\n"
          if /Flags:\s*(\S+)$/;

        print "hHW_SCSIRAID_PORT_$type\_vol-$vol\_phy$ldi\_syncprogress|$1\n"
          if /Synchronized:\s*(\d+)%/;


# 3ware (all)
if (map {$_ =~ /3ware/i} @sysctl) {
  my (%units, @controlers, %models);

  chomp(my @twCliInfo = `\/usr\/local\/sbin\/tw_cli info 2>\/dev\/null`);

  # parse tw_cli basis view:
  foreach my $line (@twCliInfo) {
    if ($line =~ m/Controller (\d+):/)  { push @controlers, $1;}
    if ($line =~ /^c(\d+)\s+(\S+)\s+/)  { push @controlers, $1; $models{$1} = $2;}

  foreach my $controler (@controlers) {
    chomp(@twCliInfo = `\/usr\/local\/sbin\/tw_cli info c$controler 2>\/dev\/null`);

    # parse tw_cli detailed info:
    foreach my $line (@twCliInfo) {
      if ( $line =~ m/Unit\s(\d):\s+(RAID\s+\d+|[^\s]+)\s([^\s]+)\s([^\s]+)[^:]+:\s(.+)/) {
        print "hHW_SCSIRAID_UNIT_c$controler\_u$1_capacity|$3 $4\n";
        print "hHW_SCSIRAID_UNIT_c$controler\_u$1_type|$2\n";
        print "hHW_SCSIRAID_UNIT_c$controler\_u$1_status|$5\n";
      if ( $line =~ m/Port\s(\d+):\s([^\s]+)\s([^\s]+)\s([^\s]+)\s([^\s]+)\s([^\s]+)[^:]+:\s([^\(]+)\(unit\s(\d+)/) {
        print "hHW_SCSIRAID_PORT_c$controler\_u$8_phy$1_capacity|$5 $6\n";
        print "hHW_SCSIRAID_PORT_c$controler\_u$8_phy$1_model|$2 $3\n";
        print "hHW_SCSIRAID_PORT_c$controler\_u$8_phy$1_status|$7\n";
        if (! exists $units{$controler}{$8}) {$units{$controler}{$8} = 0;}
        $units{$controler}{$8} = $units{$controler}{$8} + 1;

      # 3ware models: 7xxx, 8xxx, 9xxx, 95xx:
      # Units:
      # ONLY FreeBSD: 
      # Unit  UnitType  Status         %RCmpl  %V/I/M  Stripe  Size(GB)  Cache  AVrfy
      if (  $line =~ /^u(\d+)\s+(RAID\-\d+)\s+(\S+)\s+\S+\s+\S+\s+(\S+)\s+(\S+).*/ )
        print "hHW_SCSIRAID_UNIT_c$controler\_u$1_capacity|$5 GB\n";
        print "hHW_SCSIRAID_UNIT_c$controler\_u$1_type|$2\n";
        print "hHW_SCSIRAID_UNIT_c$controler\_u$1_status|$3\n";
      # Ports:
      if ( $line =~ /^p(\d+)\s+(\S+)\s+u(\S+)\s+(\S+\s\S+)\s+(\d+)\s+(\S+)\s*$/ )

        print "hHW_SCSIRAID_PORT_c$controler\_u$3_phy$1_capacity|$4\n";
        print "hHW_SCSIRAID_PORT_c$controler\_u$3_phy$1_serial|$6\n";
        print "hHW_SCSIRAID_PORT_c$controler\_u$3_phy$1_status|$2\n";

        if (! exists $units{$controler}{$3}) {$units{$controler}{$3} = 0;}
        $units{$controler}{$3} += 1 if $2 ne "NOT-PRESENT";

        my $p = $1;
        my $u = $3;
        chomp(my $model = `\/usr\/local\/sbin\/tw_cli info c$controler p$p model 2>\/dev\/null`);
        print "hHW_SCSIRAID_PORT_c$controler\_u$u\_phy$p\_model|$1\n"
          if $model =~ /Model\s+=\s+(.*)$/;

    foreach (keys %{$units{$controler}}) {print "hHW_SCSIRAID_UNIT_c$controler\_u$_\_phys|".($units{$controler}{$_})."\n";}
    print "hHW_SCSIRAID_CONTROLLER_c$controler\_model|$models{$controler}\n" if defined $models{$controler};
} elsif (map {$_ =~ /LSILogic/i} @sysctl) {
  # LSILOGIC MPT adapter:

  my (%units, $count);
  chomp(my @dmesg = `dmesg | grep "mpt"`);
  chomp(my @camcontrolDevlist = `\/sbin\/camcontrol devlist`);

  # check UNIT number:
  $count = 0;
  while(my $a = grep {$_ =~ /^mpt$count: (\d+) Active Volume/i} @dmesg) {
    $units{$count}{volumeCount} = $a;

  # foreach unit (mpt0, mpt1, ...)
  foreach my $u (keys %units){

      /^mpt$u:\s*(\d+).*Drive Members/i and $units{$u}{driveCount} = $1;
      /^mpt$u: Capabilities: \( (.*?) \)$/i and $units{$u}{capabilities} = $1;

    # foreach volume: (vol0, vol1, ...)
    for(my $volume=0; $volume<$units{$u}{volumeCount}; $volume++){
      my @revDmesg = reverse @dmesg;
      my ($lastVolStatus, $lastSyncPercent, $lastFlags);

      foreach(@revDmesg) {
        # print capacity of the volume using bus/target/lun from dmesg,
        # from the line with unix device (ad0) at bus .. target .. lun ..
        # WARNING: we assume that unix device numeration is same as scsi volume numeration
        # example:
        # daX is on scsi volume X
        # TODO improve this
        if(/.*$volume at mpt$u bus (\d+) target (\d+) lun (\d+)/){
          chomp(my $c = `\/sbin\/camcontrol readcap $1:$2:$3 -q`);
          if($c =~ /^(\d+),\s*(\d+)$/){
            print "hHW_SCSIRAID_UNIT_mpt$u\_vol-id$volume\_capacity|".(normalize($1*$2))."\n";

        next unless /mpt$u:vol$volume/;

        # status:
        if(/: Status \( (.*?) \)$/ and not $lastFlags){ $lastFlags = uc $1; }

        # state:
        if(/: RAID-\d+ - (.*)$/i){ $lastVolStatus = uc $1;}

        # sync percentage:
        if(/: (\d+) of (\d+) blocks remaining/i){ $lastSyncPercent = int($1/$2 * 100); }

        # we search backwards only till this line:
        last if /Volume Status Changed/;

      print "hHW_SCSIRAID_UNIT_mpt$u\_vol-id$volume\_flags|$lastFlags\n";
      print "hHW_SCSIRAID_UNIT_mpt$u\_vol-id$volume\_status|$lastVolStatus\n";
      print "hHW_SCSIRAID_UNIT_mpt$u\_vol-id$volume\_type|$units{$u}{capabilities}\n";
      print "hHW_SCSIRAID_UNIT_mpt$u\_vol-id$volume\_phys|".$units{$u}{driveCount}."\n";
      print "hHW_SCSIRAID_UNIT_mpt$u\_vol-id$volume\_syncprogress|$lastSyncPercent\n"
        if $lastFlags =~ /syncing/i;

      # foreach drive in volume
      for(my $d=0; $d<$units{$u}{driveCount}; $d++){
        my $lastStatus = ''; 
        my $lastFlags = '';

        foreach(@revDmesg) {
          next unless /^\(mpt$u:vol$volume:$d\):/;

          if(/\(mpt$u:vol$volume:$d\): Status \( (.*) \)$/ and not $lastFlags){
            $lastFlags = uc $1;
          } elsif(/\(mpt$u:vol$volume:$d\): Physical.* Pass-thru \(mpt$u:(\d+):(\d+):(\d+)\)\s*$/){
            my ($bus, $target, $lun) = ($1, $2, $3);
              /<(.*?)>\s+at scbus$bus target $target lun $lun/
                and print "hHW_SCSIRAID_PORT_mpt$u\_vol-id$volume\_phy$d\_model|$1\n"
                and last;
            chomp(my $c = `\/sbin\/camcontrol readcap $bus:$target:$lun -q`);
            print "hHW_SCSIRAID_PORT_mpt$u\_vol-id$volume\_phy$d\_capacity|".(normalize($1*$2))."\n"
              if ($c =~ /^(\d+),\s*(\d+)$/);
            # none
          } elsif(/\(mpt$u:vol$volume:$d\): Volume Status Changed.*$/){
            # none
          } elsif(/\(mpt$u:vol$volume:$d\): (.*)$/ and not $lastStatus){
            $lastStatus = uc $1;

          # we search backwards only till this line:
          last if /Physical Disk Status Changed/;
        $lastFlags = 'NONE' if $lastFlags eq 'ENABLED' or $lastFlags eq '';

        print "hHW_SCSIRAID_PORT_mpt$u\_vol-id$volume\_phy$d\_status|$lastStatus\n";
        print "hHW_SCSIRAID_PORT_mpt$u\_vol-id$volume\_phy$d\_flags|$lastFlags\n";

sub normalize {
  my $bytes = shift || return 0;
  my @units = qw/KB MB GB TB PB/;
  my $i = -1;

  # if we get bytes/MB/TB and still want to normalize:
  if($bytes =~ /^(\d+)\s*([a-zA-Z]+)\s*$/){
    $bytes = $1;
    my $unit = $2;
      last if uc($unit) eq $_;
  return -1 if $bytes > 1024 and $i >= $#units; # error

  while($bytes > 1024){
    $bytes = int($bytes/1024);
  return $bytes." $units[$i]";

    chown 0:0 "$DIR_SCRIPTS_HOUR/"
    chmod 750 "$DIR_SCRIPTS_HOUR/"

# Generate /scripts/hour/ file
generate_smart() {
    echo "Generating $DIR_SCRIPTS_HOUR/"
    cat << EOF > $DIR_SCRIPTS_HOUR/
#! /usr/local/bin/perl

\$ENV{"LC_ALL"} = "POSIX";

    cat <<'EOF' >> $DIR_SCRIPTS_HOUR/
# This script monitors SMART Errors count and critical SMART values.

# TODO:  LSI Logic or Mylex smart error detection (via scsi?)

use strict;
use IO::Select;

exit if (! -e '/usr/local/sbin/smartctl');

my %smartData;

sub parse_smartctl_line {
  my $line = shift;
  my $dev = shift;

  if($line =~ /^SMART Attributes Data Structure revision number: (\d+\w*)$/) {
    print "hINFO_RTM_SMART_versionnotcompatible|$1\n"
      unless $1 eq '10';

  if($line =~ /^SMART overall-health.*result: (\w+)$/) {
  #  $1 - PASSED or problem description
    print "hINFO_HDD_$dev\_SMART-SELF_overall-health-test|$1\n"
      if $1 and $1 ne 'PASSED';

  # Check for Vendor Specific SMART Attributes with Thresholds:
  if ($line =~ /^(\s{0,2}\d{1,3})\s+(\w+)\s+0x[\dabcdef]{4}\s+(\d+)\s+(\d+)\s+(\d+)\s+(\w+)\s+\w+\s+(\w+)\s+\d+.*$/) {
    # $1 - ID           arr[0] 
    # $2 - name         arr[1]
    # $3 - value        arr[2]
    # $4 - worst        arr[3]
    # $5 - thresh       arr[4]
    # $6 - type         arr[5]
    # $7 - when failed  arr[6]
    my @arr = ($1, $2, $3, $4, $5, $6, $7);

    # we want only Pre-fail type attributes:
    if($6 =~ /Pre-fail/i) {
      my $n = $arr[1];
      $n =~ s/_/-/g;
      $n = lc($n);

      print "hINFO_HDD_$dev\_SMART-ATTR_$n|$arr[6]\n"
        if $arr[6] ne "-";

  # check for number of ATA errors:
  if ($line =~ /^ATA Error Count: (\d+)$/) {
    print "hINFO_HDD_$dev\_SMART-ATA_error-count|$1\n"
      if $1 > 0;

sub check_ide {
  chomp(my $d = `\/sbin\/sysctl -n kern.disks 2>\/dev\/null`);
  my @diskList = split ' ', $d;

  foreach my $dev (@diskList) {
    next if $dev =~ /^ad/;
    chomp(my @smartctlData = `\/usr\/local\/sbin\/smartctl -a \/dev\/$dev 2>\/dev\/null`);
    foreach my $line (@smartctlData) {
      parse_smartctl_line($line, $dev);

sub check_scsi {
  chomp(my $d = `\/sbin\/sysctl -n kern.disks 2>\/dev\/null`);
  my @diskList = split ' ', $d;

  foreach my $dev (@diskList) {
    next if $dev =~ /^da/;
    chomp(my @smartctlData = `\/usr\/local\/sbin\/smartctl -a \/dev\/$dev 2>\/dev\/null`);
    foreach my $line (@smartctlData) {
      if ($line =~ /^read:.+(\d+)$/) {
        print "hINFO_HDD_$dev\_SMART_uncorrected-read-errors|$1\n";
      if ($line =~ /^write:.+(\d+)$/) {
        print "hINFO_HDD_$dev\_SMART_uncorrected-write-errors|$1\n";

sub _3ware_get_ports_for_disk {
  my $disk = shift;
  my @ports = ();
  open my $TWCLI_OUTPUT, "\/usr\/local\/sbin\/tw_cli info c$disk 2>\/dev\/null |" or die("failed to run 'tw_cli'");
  while (<$TWCLI_OUTPUT>) {
    next unless /^p(\d+) /;
    push @ports, $1;
  close $TWCLI_OUTPUT;
  return @ports;

sub check_3ware {
  my (@controlers, $read_set);
  chomp(my @twCliInfo = `\/usr\/local\/sbin\/tw_cli info 2>\/dev\/null`);
  map {push @controlers, $1 if /^c(\d+)\s+/} @twCliInfo;
  my $name;
  $name = "twe" if </dev/twe?>; # twe for 6/7/8000 series controller
  $name = "twa" if </dev/twa?>; # twa for 9000 series controller
  return unless $name;

  $read_set = IO::Select->new();
  foreach my $controler (@controlers) {
    next unless $controler =~ /^\d+$/;
    foreach my $port (_3ware_get_ports_for_disk($controler)) {
      pipe my $P_READ, my $P_WRITE or die "pipe(): $!";
      my $pid = fork();
      die "cannot fork: $!" if $pid < 0;
      if ($pid == 0) {
        open my $SMARTCTL_OUTPUT, "\/usr\/local\/sbin\/smartctl --device=3ware,$port /dev/${name}$controler -a |" or die("failed to run smartctl");
        close $P_READ;
        while (<$SMARTCTL_OUTPUT>) {
          parse_smartctl_line($_, "${name}$controler-$port");
      close $P_WRITE;
  while (my @fds = $read_set->can_read()) {
    foreach my $fd (@fds) {
      my @lines = <$fd>;
      if (!@lines) {
        close $fd;
      print join('', @lines);
  while (waitpid(-1, 0) > 0) {

    chown 0:0 "$DIR_SCRIPTS_HOUR/"
    chmod 750 "$DIR_SCRIPTS_HOUR/"

# Generate /scripts/hour/ file
generate_listen_ports() {
    echo "Generating $DIR_SCRIPTS_HOUR/"
    cat << EOF > $DIR_SCRIPTS_HOUR/
#! /usr/local/bin/perl

\$ENV{"LC_ALL"} = "POSIX";

    cat <<'EOF' >> $DIR_SCRIPTS_HOUR/
# This script monitors all listening TCP connections in OS.

use strict;
use utf8; # for \x{nnn} regex

my (@netstatTable, $line, $socketInfo, $procInfo, @tempTable, $port, $pid, $procName, $ip, $cmdline, $exe, @status, $statusLine, $uid, @passwd, $passwdLine, %passwdHash);

chomp(@netstatTable = `\/usr\/bin\/sockstat -lP tcp \| \/usr\/bin\/awk \'NR>1 {print \$1"|"\$2"|"\$3"|"\$6;}\'`);
map {s/\|\*:/\|; s/:(\d+)$/\|$1/;} @netstatTable;  # change to behave as on linux systems
# $netstatTable[x] = 'bind|named|517||953'

# username <=> uid transformation table
open(FILE, "/etc/passwd");
chomp(my @passwd = <FILE>);
my %passwdHash;
foreach (@passwd) {
  $passwdHash{$1} = $2;
  $passwdHash{$2} = $1;

foreach (@netstatTable) {
  my @lineTab = split /\|/;

  if ($lineTab[0] =~ /^\d+$/) {
    push @lineTab, $lineTab[0];
    $lineTab[0] = (defined $passwdHash{$lineTab[0]})?$passwdHash{$lineTab[0]}:'-';
  } elsif (defined $passwdHash{$lineTab[0]}) {
    push @lineTab, $passwdHash{$lineTab[0]};
  } else {
    push @lineTab, '-';

  # get cmdline from procfs:
  open(FILE, "/proc/$lineTab[2]/cmdline");
  chomp(my $cmdline = <FILE>);
  $cmdline =~ s/\x{0}/ /g;
  push @lineTab, $cmdline;

  # exe:
  push @lineTab, readlink("/proc/$lineTab[2]/file");

# $lineTab = [
#          'bind',                                      username
#          'named',                                     procname
#          '517',                                       PID
#          '::1',                                       listen IP
#          '953',                                       listen PORT
#          '53',                                        UID
#          '/usr/sbin/named -t /var/named -u bind ',    cmdline
#          '/usr/sbin/named'                            exe
#        ];

  print "hINFO_TCP_LISTEN_IP-$lineTab[3]\_PORT-$lineTab[4]\_pid\|$lineTab[2]\n";
  print "hINFO_TCP_LISTEN_IP-$lineTab[3]\_PORT-$lineTab[4]\_procname\|$lineTab[1]\n";
  print "hINFO_TCP_LISTEN_IP-$lineTab[3]\_PORT-$lineTab[4]\_cmdline\|$lineTab[6]\n";
  print "hINFO_TCP_LISTEN_IP-$lineTab[3]\_PORT-$lineTab[4]\_exe\|$lineTab[7]\n";
  print "hINFO_TCP_LISTEN_IP-$lineTab[3]\_PORT-$lineTab[4]\_username\|$lineTab[0]\n";
  print "hINFO_TCP_LISTEN_IP-$lineTab[3]\_PORT-$lineTab[4]\_uid\|$lineTab[5]\n";


    chown 0:0 "$DIR_SCRIPTS_HOUR/"
    chmod 750 "$DIR_SCRIPTS_HOUR/"

# Generate /scripts/min/ file
generate_usage() {
    echo "Generating $DIR_SCRIPTS_MIN/"
    cat << EOF > $DIR_SCRIPTS_MIN/
#! /usr/local/bin/perl

\$ENV{"LC_ALL"} = "POSIX";

    cat <<'EOF' >> $DIR_SCRIPTS_MIN/
# Script used for monitoring overall server load. Memory/swap/load/cpu_usage are entrained.

use strict;

# tmp file for storing cpu stats from /proc/stat (Linux) or sysctl kern.cp_time (FreeBSD)
my $CPU_STATS_FILE = "/tmp/cpu_stats";

sub send_loadavg {
    my %loadavg = get_loadavg();
    print "mINFO_LOAD_loadavg1|" . $loadavg{'loadavg1'} . "\n";
    print "mINFO_LOAD_loadavg2|" . $loadavg{'loadavg2'} . "\n";
    print "mINFO_LOAD_loadavg3|" . $loadavg{'loadavg3'} . "\n";

sub send_mem_swap_usage {
    my %mem_swap_usage = get_mem_swap_usage();
    print "mINFO_MEM_memusage|" . $mem_swap_usage{'mem_used_pr'} . "\n";
    print "mINFO_MEM_swapusage|" . $mem_swap_usage{'swap_used_pr'} . "\n";

sub send_cpu_usage {
    my $cpu_usage = get_cpu_usage();
    print "mINFO_CPU_usage|" . $cpu_usage . "\n";

sub send_hdd_usage {
    my %hdd_usage = get_hdd_usage();
    foreach (keys %{$hdd_usage{'usage'}}) {
        print "mINFO_PART_$_\_mount|" . $hdd_usage{'mount'}{$_} . "\n";
        print "mINFO_PART_$_\_usage|" . $hdd_usage{'usage'}{$_} . "\n";
        print "mINFO_PART_$_\_inodes|" . $hdd_usage{'inodes'}{$_} . "\n";

sub get_loadavg {
    chomp(my $load = `\/sbin\/sysctl vm.loadavg 2>\/dev\/null`);
    $load =~ s/.*{\s*(.*)\s*}.*/$1/;
    chomp(my @load = split(/\s/, $load));
    return ('loadavg1' => $load[0],
            'loadavg2' => $load[1],
            'loadavg3' => $load[2],);

sub get_cpu_usage {
    my ($cpu_usage, @cpu_usage1, @cpu_usage2, $delta);
    @cpu_usage1 = (0, 0, 0, 0);
    @cpu_usage2 = (0, 0, 0, 0);

    chomp(my $cpu_time = `\/sbin\/sysctl kern.cp_time 2>\/dev\/null`);
    if ($cpu_time =~ /^kern.cp_time:\s+(\d+)\s+(\d+)\s+(\d+)\s+(\d+)\s+(\d+)\s*$/i) {
        # CPU USAGE LINUX:      user, nice, system, idle
        # CPU USAGE FreeBSD:    user, nice, system, interrupt, idle
        @cpu_usage2 = ($1, $2, $3, $5);

    # get historical stats:
    if(-e $CPU_STATS_FILE) {
      open(TMP, "+< $CPU_STATS_FILE") or die "$CPU_STATS_FILE: $!\n";
      while (<TMP>) {
          if (/^kern.cp_time:\s+(\d+)\s+(\d+)\s+(\d+)\s+(\d+)\s+(\d+)\s*$/i) {
              @cpu_usage1 = ($1, $2, $3, $5);
      seek(TMP, 0, 0);
    } else {
      # if there is no historical data, use actual as a historical:
      open(TMP, "> $CPU_STATS_FILE") or die "$CPU_STATS_FILE: $!\n";
      @cpu_usage1 = @cpu_usage2 ;
    print TMP $cpu_time;
    close (TMP);

    $delta = $cpu_usage2[0]+$cpu_usage2[1]+$cpu_usage2[2]+$cpu_usage2[3]-
    if ($delta > 0) {
        $cpu_usage = sprintf("%d", 100-(($cpu_usage2[3]-$cpu_usage1[3])/$delta*100));
    } else {
        $cpu_usage = 0;
    return $cpu_usage;

sub get_mem_swap_usage {

    my %mem_swap_usage = ();
    chomp(my @swap = `\/sbin\/swapctl -kl \| grep "\/dev"`);
    my %swap;
    map { /^\/dev.*\s+(\d+)\s+(\d+)\s*$/; $swap{'total'}+=($1*1024); $swap{'used'}+=($2*1024);} @swap; # when we have more than one swap partition
    $mem_swap_usage{'swap_total'} = $swap{'total'};
    $mem_swap_usage{'swap_used'} = $swap{'used'};
    if ($swap{'total'} == 0) {
        # prevent division by zero   
        $mem_swap_usage{'swap_used_pr'} = 0;
    } else {
        $mem_swap_usage{'swap_used_pr'} = sprintf("%d", $swap{'used'}/$swap{'total'}*100);

    my %mem_usage;

    # page size
    chomp(my $page_size = `\/sbin\/sysctl -n vm.stats.vm.v_page_size 2>\/dev\/null`);

    # number of total memory pages 
    chomp(my $mem_size_c = `\/sbin\/sysctl -n vm.stats.vm.v_page_count 2>\/dev\/null`);

    # pages without data content
    chomp(my $free_c = `\/sbin\/sysctl -n vm.stats.vm.v_free_count`);

    # pages that have percolated from inactive to a status where they maintain their data, but can often be immediately reused
    chomp(my $cached_c = `\/sbin\/sysctl -n vm.stats.vm.v_cache_count 2>\/dev\/null`);

    # pages used for filesystem buffers
    chomp(my $buffers = `\/sbin\/sysctl -n vfs.bufspace 2>\/dev\/null`);

    # pages that are fixed into memory, usually for kernel purposes, but also sometimes for special use in processes
    chomp(my $wired_c = `\/sbin\/sysctl -n vm.stats.vm.v_wire_count 2>\/dev\/null`);

    $mem_usage{'mem_total'} = $page_size * $mem_size_c;
    $mem_usage{'mem_free'} = $page_size * $free_c;
#    $mem_usage{'mem_shared'} = 
    $mem_usage{'mem_buffers'} = $buffers;
    $mem_usage{'mem_wired'} = $page_size * $wired_c;
    $mem_usage{'mem_cached'} = $page_size * $cached_c;

    $mem_usage{'mem_used'} = $mem_usage{'mem_total'} - $mem_usage{'mem_free'} - $mem_usage{'mem_cached'} - $mem_usage{'mem_buffers'};                          
    $mem_usage{'mem_used_pr'} = ($mem_usage{'mem_total'} > 0)?sprintf("%d", (($mem_usage{'mem_used'})/$mem_usage{'mem_total'}*100)):0;

    return (%mem_swap_usage, %mem_usage);

sub get_hdd_usage {
    my %hdd_usage = ();

    # inodes and usage:
    chomp(my @df = `\/bin\/df -lkPi 2>\/dev\/null`);
    foreach (@df) {
        if (/^(\/dev\/\S+)\s+(\d+)\s+(\d+)\s+(\d+)\s+(\S+)%\s+(\S+)\s+(\S+)\s+(\S+)%\s+(\S+)\s*$/i) {
            my $hdd_name = $1;
            my $mount = $9;
            my $usage = $5;
            my $inodes = $8;

            $hdd_name =~ s!^/dev/!!;
            $hdd_name =~  s!/!-!g;
            $hdd_usage{'usage'}{$hdd_name} = $usage;
            $hdd_usage{'mount'}{$hdd_name} = $mount;
            $hdd_usage{'inodes'}{$hdd_name} = ($inodes =~ /^\d+$/)?$inodes:0;
    return %hdd_usage;

    chmod 750 "$DIR_SCRIPTS_MIN/"

# Generate /scripts/min/ file
generate_usage_root() {
    echo "Generating $DIR_SCRIPTS_MIN/"
    cat << EOF > $DIR_SCRIPTS_MIN/
#! /usr/local/bin/perl

\$ENV{"LC_ALL"} = "POSIX";

    cat <<'EOF' >> $DIR_SCRIPTS_MIN/
# This script monitors TOP processes 

use strict;

sub send_process {
    my %processes = get_processes();
    print "mINFO_LOAD_processesactive|" . $processes{'processesactive'} . "\n";
    print "mINFO_LOAD_processesup|" . $processes{'processesup'} . "\n";

sub send_top_rss {
    my $top = get_top_mem_procs();
    my $n = 1;
    foreach my $info (@$top) {
        my $vsz = $info->[0];
        my $cmd = $info->[1];
        printf "mINFO_MEM_top_mem_%02d_name|%s\n", $n, $cmd;
        printf "mINFO_MEM_top_mem_%02d_size|%s\n", $n, $vsz;

sub get_processes {
    #chomp(my @rtm_sids = `ps --no-headers -C rtm -o sess | sort -n | uniq`);
    chomp(my @rtm_sids = `\/bin\/ps -o sid,command \| \/usr\/bin\/grep "rtm" \| \/usr\/bin\/sort -n \| \/usr\/bin\/uniq \| \/usr\/bin\/grep -v grep`);
    #my @ps_output = `ps --no-headers -A -o sess,state,command`;
    chomp(my @ps_output = `\/bin\/ps -A -o sid,state,command`);
    shift @ps_output; # shift headers :)

    my $active = 0;
    my $total = 0;
    foreach my $line (@ps_output) {
        next if $line !~ /(\d+)\s+(\S+)/;
        my $sid = $1;
        my $state = $2;
        if (grep $sid == $_, @rtm_sids) {
        ++$active if $state =~ /^R/;
    return ('processesactive' => $active, 'processesup' => $total);

sub get_top_mem_procs {
    my @top;
    chomp(my @output = `\/bin\/ps -A -ovsz,command \| \/usr\/bin\/awk 'NR>1 {print}' \| \/usr\/bin\/sort -nrk1 \| \/usr\/bin\/grep -v "sort" \| \/usr\/bin\/head -n5`);
    return [] unless $? == 0;
    foreach (@output) {
        next unless m/\s*(\d+)\s+(.+)/;
        push @top, [$1, $2];
    return \@top;

    chown 0:0 "$DIR_SCRIPTS_MIN/"
    chmod 750 "$DIR_SCRIPTS_MIN/"

# Generate /scripts/hour/ file
generate_hwinfo() {
    echo "Generating $DIR_SCRIPTS_HOUR/"
    cat << EOF > $DIR_SCRIPTS_HOUR/
#! /usr/local/bin/perl

\$ENV{"LC_ALL"} = "POSIX";

    cat <<'EOF' >> $DIR_SCRIPTS_HOUR/
use strict;

sub send_cpu_info {
    my %cpu_info = get_cpu_info();
    print "dHW_CPU_name|" . $cpu_info{'cpu_name'} . "\n";
    print "dHW_CPU_mhz|" . $cpu_info{'cpu_mhz'} . "\n";
    print "dHW_CPU_cache|" . $cpu_info{'cpu_cache'} . "\n";
    print "dHW_CPU_number|" . $cpu_info{'cpu_no'} . "\n";

sub send_lspci_info {
    my %lspci_info = get_lspci_info();
    foreach (keys %lspci_info) {
        my $tempKey = $_;
        $tempKey =~ s/\:|\.|\_/-/g;
        print "dHW_LSPCI_PCI-$tempKey|" . $lspci_info{$_} . "\n";

sub get_cpu_info {
    my %cpu_info = ( 'cpu_no' => 0 );

    chomp(my @cpuinfo = `\/sbin\/sysctl hw dev.cpu 2>\/dev\/null`);

    foreach(@cpuinfo) {
        if (/^hw\.model:\s*(.*)$/) {
            $cpu_info{'cpu_name'} = $1;
        if (/^dev\.cpu\.\d{1,2}\.freq:\s*(.*)$/) {
            $cpu_info{'cpu_mhz'} = $1;
# TODO - FreeBSD no CPU cache found!
#        if ($_ =~ /^cache size/) {
#            s/cache size\s+:\s*//g;
#            $cpu_info{'cpu_cache'} = $_;
#        }
        if (/^hw\.ncpu:\s*(.*)$/){
            $cpu_info{'cpu_no'} = $1;


    $cpu_info{'cpu_cache'} = '';

    return %cpu_info;

sub get_lspci_info {
    my %lspci_info = ();
    chomp(my @pciconf = `\/usr\/sbin\/pciconf -l 2>\/dev\/null`);
    if ($? == 0) {
        foreach (@pciconf) {
                # $1 - selector
                # $2 - class
                # $3 - subvendor device id
                # $4 - subvendor id
                # $5 - vendor device id
                # $6 - vendor id
                # $7 - revision
                # $8 - describes the header type (see man for pciconf)
                my $value = "$6:$5";
                my $selector;
                $_ = $1;
                while (/(\w+)(\W+)?/g) {$selector .= length($1)==1?"0$1$2":"$1$2";}
                $lspci_info{$selector} = $value;

    return %lspci_info;

    chmod 750 "$DIR_SCRIPTS_HOUR/"

# Generate /scripts/hour/ file
generate_hwinfo_root() {
    echo "Generating $DIR_SCRIPTS_HOUR/"
    cat << EOF > $DIR_SCRIPTS_HOUR/
#! /usr/local/bin/perl

\$ENV{"LC_ALL"} = "POSIX";

    cat <<'EOF' >> $DIR_SCRIPTS_HOUR/
use strict;

chomp(my @dmesg = `\/sbin\/dmesg 2>\/dev\/null`);
chomp(my @sysctl = `\/sbin\/sysctl dev 2>\/dev\/null`);

sub send_mainboard_memory_info {
    my %mainboard_memory_info = get_mainboard_memory_info();
    print "dHW_MB_manufacture|" . $mainboard_memory_info{'mainboard'}{'manufacture'} . "\n";
    print "dHW_MB_name|" . $mainboard_memory_info{'mainboard'}{'name'} . "\n";
    foreach (keys %{$mainboard_memory_info{'memory'}}) {
        print "dHW_MEM_BANK-$_|" . $mainboard_memory_info{'memory'}{$_} . "\n";

sub send_hdd_info {
    my $hdd_info = get_hdd_info();
    foreach (keys %{$hdd_info->{'model'}}) {
        print "dHW_HDD_$_\_capacity|" . $hdd_info->{'capacity'}{$_} . "\n";
        print "dHW_HDD_$_\_model|" . $hdd_info->{'model'}{$_} . "\n";

sub get_mainboard_memory_info {
    my %mainboard_memory_info = ();
    my @dmidecode = `dmidecode 2>/dev/null`;
    if ($? == 0) {
        my $module = "";
        for (my $i = 0; $i < @dmidecode; $i++) {
            if($dmidecode[$i] =~ /^\s*Base Board Information/i) {
                $dmidecode[$i+1] =~ s/Manufacturer://g;
                $dmidecode[$i+2] =~ s/Product Name://g;
                $mainboard_memory_info{'mainboard'}{'manufacture'} = $dmidecode[$i+1];
                $mainboard_memory_info{'mainboard'}{'name'} = $dmidecode[$i+2];
            if($dmidecode[$i] =~ /^\s*Memory Module Information/i) {
                $dmidecode[$i+1] =~ /^\s+(\S+)\s+(\S+)\s+(.+)$/i;
                $module = $3;
                $module =~ s/\W/-/g;
            if(($dmidecode[$i] =~ /^\s+Installed Size:/i)  && ($module =~ /\S+/)) {
                $module =~ s/#/_/;
                $dmidecode[$i] =~ s/Installed Size://g;
                $mainboard_memory_info{'memory'}{$module} = $dmidecode[$i];
                $mainboard_memory_info{'memory'}{$module} =~ s/^\s+//;
                $module = "";
        if (!defined $mainboard_memory_info{'memory'}) {
            for (my $i = 0; $i < @dmidecode; $i++){
                if($dmidecode[$i] =~ /^\s*Memory Device/i) {
                    my $bank = $dmidecode[$i+9];
                    $bank =~ /Bank Locator:\s+(.*)/;
                    $bank = $1;
                    next if !$bank;
                    $bank =~ s/\s//g;
                    $bank =~ s/[\s\.\/\\_]/-/g;
                    my $locator = $dmidecode[$i+8];
                    $locator =~ /Locator:\s+(.*)/;
                    $locator = $1;
                    next if !$locator;
                    $locator =~ s/\s//g;
                    $locator =~ s![\s./\\_\#]!-!g;
                    my $size = $dmidecode[$i+5];
                    $size =~ /Size:\s+(.*)/;
                    $size = $1;
                    next if !$size;
                    $size =~ s/\s*MB\s*//g;
                    if ($bank . $locator ne "") {
                        $mainboard_memory_info{'memory'}{$bank . "-" . $locator} = $size;
        $mainboard_memory_info{'mainboard'}{'manufacture'} =~ s/^\s+//;
        $mainboard_memory_info{'mainboard'}{'name'} =~ s/^\s+//;
    } else {
        $mainboard_memory_info{'mainboard'}{'manufacture'} = "dmidecode not installed";
        $mainboard_memory_info{'mainboard'}{'name'} = "dmidecode not installed";
    return %mainboard_memory_info;

#sub has_raid {
#    return ((`gmirror status` =~ /mirror/) ||
#            (`gstripe status` =~ /stripe/) ||
#            (grep {$_ =~ m/3w-xxxx: scsi|scsi. : Found a 3ware|3w-9xxx: scsi.: Found|LSISAS|LSILOGIC|Mylex AcceleRAID 160 PCI RAID Controller/i} @dmesg));

sub get_disk_capacity {
    my $device = shift;
    chomp(my $capacity =  `diskinfo $device | awk '{print \$3}' 2>\/dev\/null` || 0);
    return normalize($capacity);

sub get_hdd_info {
    my %hdd_info;
    my $disks = get_disks();

    foreach my $disk (@$disks){
      if($disk =~ /^da/){         #SCSI
        # TODO
        # SCSI/SATA not supported for now under FreeBSD
#        # camcontrol devlist -v
#        # dmesg | grep mpt
#        # we don't wanna check raid volumes here
#        next if grep {$_ =~ "^$disk at mpt"} @dmesg;
#        $hdd_info{'model'}{$disk} = '';

      } elsif($disk =~ /^ad/) {   #IDE
        # atacontrol list
        chomp(my @ret = `atacontrol list`);
          $hdd_info{'model'}{$disk} = $1 and last
            if /\s*(?:Master|Slave):\s+$disk\s*<(.*?)>/;
      } else {
      $hdd_info{'capacity'}{$disk} = get_disk_capacity("/dev/$disk");

    return \%hdd_info;

sub normalize {
  my $bytes = shift || return 0;
  my @units = qw/KB MB GB TB PB/;
  my $i = -1;

  # if we get bytes/MB/TB and still want to normalize:
  if($bytes =~ /^(\d+)\s*([a-zA-Z]+)\s*$/){
    $bytes = $1;
    my $unit = $2;
      last if uc($unit) eq $_;
  return -1 if $bytes > 1024 and $i >= $#units; # error

  while($bytes > 1024){
    $bytes = int($bytes/1024);
  return $bytes.$units[$i];

sub get_disks {
  chomp(my $d = `sysctl -n kern.disks 2>\/dev\/null`);
  my @disks = split (/\s+/, $d);
  return \@disks;

    chown 0:0 "$DIR_SCRIPTS_HOUR/"
    chmod 750 "$DIR_SCRIPTS_HOUR/"

# Generate /scripts/min/ file
generate_hddinfo() {
    echo "Generating $DIR_SCRIPTS_MIN/"
    cat << EOF > $DIR_SCRIPTS_MIN/
#! /usr/local/bin/perl

\$ENV{"LC_ALL"} = "POSIX";

    cat <<'EOF' >> $DIR_SCRIPTS_MIN/
# This script provides simple disk tests and temperature

use strict;

#   hddtemp for daX disk

sub send_hdd_status {
  my @ide;
  chomp(my $i = `sysctl -n kern.disks 2>\/dev\/null`);
  map { push @ide, $_ if /^ad/} split(/\s+/,$i);

  chomp(my @status = `dmesg 2>\/dev\/null \| grep -i \"error\\\|drive not ready\" \| grep -i \"\^ad\" \| cut -f 1 -d \":\" \| sort \| uniq`);

  foreach my $ide (@ide) {
    my $error = 0;
    foreach (@status) {
      $error = 1 if $_ eq $ide;
    if ($error == 1) {
      print "mHW_HDD_$ide\_status|ERROR\n";
    } else {
      print "mHW_HDD_$ide\_status|OK\n";

  # check of scsi errors
  chomp(my @scsi = `sysctl -n kern.disks 2>\/dev\/null \| grep \"\^da\"`);

  my $possible_error;
  if (scalar @scsi > 0) {
    open my $dmesg, "dmesg |" or die "Can't launch dmesg: $!";
    my $status = 'OK';
    while (<$dmesg>) {
      if (/Info fld=([^,]+), Deferred (\S+?): sense key (.+ Error)/) {
        $status = $3;
      if (/^da.: .+?: sense key: (.+ Error)/) {
        $status = $1;
      if (/^(da.+?): *rw=\d+/) {
        $possible_error = $1;
      if (defined($possible_error) && /^attempt to access beyond/) {
        $status = 'BAD_ACCESS';
      $possible_error = undef;
    print "mHW_HDD_scsi_status|$status\n";

sub send_hdd_temp {
  my %hdd_temp = get_hdd_temp();
  foreach (keys %hdd_temp) {
    print "mINFO_HDD_$_\_temperature|" . $hdd_temp{$_} . "\n";

sub get_hdd_temp {
  my %hdd_temp = ();
  chomp(my @ide = `sysctl -n kern.disks 2>\/dev\/null`);

  foreach (@ide) {
    if (/^ad/) {
      chomp(my $temp = `\/usr\/local\/sbin\/smartctl -a \/dev\/$_ \| grep "Temperature"  2>\/dev\/null`);
      my $ide = $_;
      if ($? == 0) {
        if ($temp =~ m/\s+(\d{1,3})\s*$/) {
          $temp = $1;
        } else {
          $temp = "-1";
        $hdd_temp{$ide} = $temp;
      } else {
        $hdd_temp{$ide} = "-2";
    elsif (/^da/) {
  return %hdd_temp;

    chown 0:0 "$DIR_SCRIPTS_MIN/"
    chmod 750 "$DIR_SCRIPTS_MIN/"

# Generate file
generate_rtm() {
    echo "Generating"
    cat << EOF > $RTM_PL
#! /usr/local/bin/perl

\$ENV{"LC_ALL"} = "POSIX";

    cat <<'EOF' >> $RTM_PL
my $LF_DEFAULT = '/tmp/rtm.flock';

sub lockProcess {
  my $lf  = shift || $LF_DEFAULT || return;
  my $pid = $$;

  if (-e "$lf") {
    open(LOCKFILE, $lf) or die "Impossible to open lock file: $lf !!!";
    my $lockPID=<LOCKFILE> || "";

    if ($lockPID !~ m/^\d+$/ ) {
      warn("There is no PID in lock. Something is broken...");
      exit 1;
    } elsif (-e "/proc/$lockPID") {
      exit 0;
    warn("There is a lock file $lf, but no process for it. Overwritting lock file");

  open(LOCKFILE, ">$lf")  or die "Impossible to open lock file for writting: $lf !!!";
  print LOCKFILE $pid;

  $LF_DEFAULT = $lf;

sub unlockProcess {
  my $lf  = shift || $LF_DEFAULT || return;

use strict;
use Socket;
use Time::localtime;
use Symbol qw(gensym);
use IO::Select;
use POSIX qw(dup2);

# Check for root permission
if ($) != 0) {
    die "You are not a root!";

# Version of script
    echo "my \$version = '$VERSION';" >> $RTM_PL
    echo "my \$release_date = '$RELEASE_DATE';" >> $RTM_PL
    cat <<'EOF' >> $RTM_PL

# at this hour all information will be send
my $HOUR = 2;

# get uptime
chomp(my $uptime = `\/sbin\/sysctl -n kern.boottime 2>\/dev\/null`);
chomp(my $date = `\/bin\/date +%s 2>\/dev\/null`);
$uptime =~ s/{\s+sec = (\d+),\s+.*$/$1/;
$uptime = $date - $uptime;
die "Can't get uptime!"
    unless $uptime =~/^\d+$/;

my $script_name = $0;
# get basename of the script
$script_name =~ s/(^.*\/)//;

    echo "my \$base_dir = '$DIR';" >> $RTM_PL
    echo "my \$scripts_dir_daily = '$DIR_SCRIPTS_DAILY';" >> $RTM_PL
    echo "my \$scripts_dir_hour = '$DIR_SCRIPTS_HOUR';" >> $RTM_PL
    echo "my \$scripts_dir_min = '$DIR_SCRIPTS_MIN';" >> $RTM_PL
    echo "my \$rtm_update_ip = '$RTM_UPDATE_IP';" >> $RTM_PL
    cat <<'EOF' >> $RTM_PL

chomp(my @scripts_daily = `\/bin\/ls -1 $scripts_dir_daily`);
chomp(my @scripts_hour = `\/bin\/ls -1 $scripts_dir_hour`);
chomp(my @scripts_min = `\/bin\/ls -1 $scripts_dir_min`);

my $env_path = $ENV{'PATH'};
$ENV{'PATH'} = "/usr/local/sbin:/usr/local/bin:/root/bin:$env_path";

# global variable used to report errors from failed scripts
my $script_error = 0;

# determine rtm server ip from mrtg config
my $ipfile = "$base_dir/etc/rtm-ip";
open FP, "$ipfile" or die("failed to open '$ipfile' for reading: $!");
chomp(my $destination_ip = <FP>);
close FP;
if ($destination_ip !~ /^\d+\.\d+\.\d+\.\d+$/) {
    die "failed to read destination ip from '$ipfile': invalid ip: $destination_ip";

# lock file is defined with lockProcess() sub

my $TIMEOUT = 45;

my $tm = localtime(time);
my $hour = $tm->hour;
my $min = $tm->min;

my @scripts_to_run = ();

# per minute data
push @scripts_to_run, map { "$scripts_dir_min/$_" } @scripts_min;

# hourly data
if (scalar @ARGV == 0 or $uptime < 900 or $ARGV[0] == $min) {
    send_info("hINFO_uptime|" . $uptime);
    push @scripts_to_run, map { "$scripts_dir_hour/$_" } @scripts_hour;

# daily data
if (scalar @ARGV == 0 or $uptime < 900 or ($hour == $HOUR && $ARGV[0] == $min)) {    
    send_info("dINFO_RTM_version|" . $version);
    push @scripts_to_run, map { "$scripts_dir_daily/$_" } @scripts_daily;

# update rtm-ip daily
if (@ARGV > 0 && $hour eq $HOUR && $ARGV[0] == $min) {
    system("$rtm_update_ip &");

# run collected scripts in separate processes
my $read_set = IO::Select->new();
my %scripts_output = ();
foreach my $script (@scripts_to_run) {
    my $P_STDOUT_READ = gensym();
    my $P_STDOUT_WRITE = gensym();
    my $P_STDERR_READ = gensym();
    my $P_STDERR_WRITE = gensym();
    pipe $P_STDOUT_READ, $P_STDOUT_WRITE or die "pipe(): $!";
    pipe $P_STDERR_READ, $P_STDERR_WRITE or die "pipe(): $!";
    my @stats = stat($script);
    my $uid =  $stats[4];

    my $pid = fork();
    die "cannot fork: $!" if $pid < 0;
    if ($pid == 0) {
        if($uid > 0) {
            my $gid =  $stats[5];
            drop_priv($uid, $gid)

        dup2(fileno($P_STDOUT_WRITE), 1) or die "dup2(): $!";
        dup2(fileno($P_STDERR_WRITE), 2) or die "dup2(): $!";
        close $P_STDOUT_READ;
        close $P_STDERR_READ;
        close $P_STDOUT_WRITE;
        close $P_STDERR_WRITE;
        my $error = "timeout";
        my $ok = eval {
            local $SIG{ALRM} = sub { die; };
            if ($? == -1) {
                $error = "failed to execute '$script': $!";
        if (!defined($ok)) {
            print STDERR "$error";
            exit 1;
    close $P_STDOUT_WRITE;
    close $P_STDERR_WRITE;
    $scripts_output{$pid} = { 'script' => $script,
                              'stdout' => $P_STDOUT_READ,
                              'stderr' => $P_STDERR_READ,
                              'error' => [],

# wait for all scripts to complete
while (my @fds = $read_set->can_read()) {
    foreach my $fd (@fds) {
        my $slot;
        foreach my $s (values %scripts_output) {
            if ($s->{'stdout'} == $fd || $s->{'stderr'} == $fd) {
                $slot = $s;
        unless (defined($slot)) {
            warn "FATAL: got event on unknown file descriptor!";
            close $fd;
        my $line = <$fd>;
        if (!$line) {
            close $fd;
        if ($fd == $slot->{'stderr'}) {
            push @{$slot->{'error'}}, $line;
            print STDERR "$line\n";
        } else {
while (1) {
    my $pid = waitpid(-1, 0);
    last unless $pid > 0;
    $scripts_output{$pid}->{'status'} = $? >> 8;

# find scripts which returned error
foreach my $slot (values %scripts_output) {
    next if $slot->{'status'} == 0;
    $slot->{'script'} =~ m!/([^/]+?)$!;
    my $script_name = $1;
    my $stderr = join ' ', map { chomp; $_ } @{$slot->{'error'}}; # perl sucks
    if (length $stderr > 20) {
        $stderr = substr($stderr, 0, 150);
        $stderr .= '...';
    $script_error = "1 $script_name $stderr";
    # TODO: it currently sends errors for the first failed script


exit 0;

sub send_info {
    my $message = shift;

    my $port = 6100 + int(rand(100));

    my $ok = eval {
        local $SIG{ALRM} = sub { print "rtm timeout\n"; die; };

        my $proto = getprotobyname('udp');
        socket(Socket_Handle, PF_INET, SOCK_DGRAM, $proto);
        my $iaddr = gethostbyname($destination_ip);
        my $sin = sockaddr_in("$port", $iaddr);
        send(Socket_Handle, "rtm $message", 10, $sin);
        print "rtm $message\n";
    if (!defined($ok)) {
        $script_error = "1 send_info() rtm timeout";
        warn "error: $@\n";

sub drop_priv {
    my ($uid, $gid) = @_;

    # set EGID
    $) = "$gid $gid";
    # set EUID
    $> = $uid + 0;
    if ($> != $uid) {
        die "Can't drop EUID.";
    chown 0:0 "$RTM_PL"
    chmod 750 "$RTM_PL"

# ^L
# Generate file
generate_rtm_update_ip() {
    echo "Generating"
    cat << EOF > $RTM_UPDATE_IP.tmp
#! /bin/sh


    cat <<'EOF' >> $RTM_UPDATE_IP.tmp
    echo "DIR='$DIR'" >> $RTM_UPDATE_IP.tmp
    cat <<'EOF' >> $RTM_UPDATE_IP.tmp

get_interface_ip() {
    ifconfig $iface 2>\/dev\/null | grep "inet.*netmask" | awk '{print $2}' | egrep '[0-9]+(\.[0-9]+){3}'

mainif="$(netstat -rn|grep "^default" | awk '{print $NF}'|sort|uniq|head -n1)"
mainip="$(get_interface_ip $mainif)"

arpa=`echo "$mainip" | sed "s/\./ /g" | awk '{print $3"."$2"."$1}'`;
ip=`host -t A mrtg.$ $DNSSERVER 2>/dev/null | tail -n 1 | sed -ne 's/.*[\t ]\([0-9]\+\.[0-9]\+\.[0-9]\+\.[0-9]\+\).*/\1/p'`
if [ -z "$ip" ]; then
  echo "No IP from OVH network !"
  exit 1;
echo $ip > "$DIR/etc/rtm-ip"

    chown 0:0 "$RTM_UPDATE_IP.tmp"
    chmod 750 "$RTM_UPDATE_IP.tmp"
    mv "$RTM_UPDATE_IP.tmp" "$RTM_UPDATE_IP"
    test -f $DIR/bin/ && rm $DIR/bin/

lock_process() {
    if [ -e "$lockfile" ]; then
        lockpid=`cat "$lockfile"`
        if [ -e "/proc/$lockpid" ]; then
            echo "there seems to be stale $scriptname process running. check \"ps aux | grep $scriptname\"" >&2
            exit 1;
        echo "Lock $lockfile with pid $lockpid exist for script $scriptname but no process not exist, replaced by new one!!" >&2
        echo $$ > "$lockfile"
    echo $$ > "$lockfile.$$"
    mv "$lockfile.$$" "$lockfile"

unlock_process() {
    rm -f "$lockfile"

wait_for_lock() {
    echo "Waiting for finish rtm running from CRON"
    for i in `\/usr\/bin\/jot - 1 30`; do
        if [ -e "$lockfile" ]; then
            echo -n "."
            sleep 2
            echo -e "\nFinished."

# RTM installation code

if [ -e "$lockfile" ]; then

# Generate selected scripts
for script in $SCRIPTS_TO_INSTALL; do


if [ -e "$RTM_SH" ];then
    mv $RTM_SH $RTM_SH.old
ln -s $RTM_PL $RTM_SH

rm -rf /rpms

if [ -z "`cat $CRONTAB | grep \"$RTM_SH\"`" ]; then
  minute=`perl -e 'print ((rand()*100)%60)'`
  CRONTABLINE='*/1 * * * * root '$RTM_SH' '$minute' > /dev/null 2> /dev/null'
    perl -pe 's!>/dev/null!> /dev/null!g' -i "$CRONTAB"

# List entries in crontab
echo ""
echo "Crontab entries:"
sleep 2
echo ""
# restarting CRON
for i in `jot 5 1` ; do
  echo "Restarting CRON. Try $i"
  if [ -x "/etc/rc.d/crond" ];then
    killall -9 crond
    $SCREEN /etc/rc.d/init.d/crond restart
  elif [ -x "/etc/rc.d/cron" ];then
    killall -9 cron
    $SCREEN /etc/rc.d/cron restart
    echo "WARNING: Didn't find any method of restarting cron on your distribution!" >&2
  sleep 2
  if [ -z "`ps aux | grep -v grep |grep cron`" ]; then
    echo "Cron didn't start."

if [ -z "`ps aux | grep -v grep | grep cron`" ]; then
  echo "Please check it!"
  sleep 10
  echo "CRON restarted succefully."
  sleep 2

echo ""
echo "in $DIR_SCRIPTS_MIN/ you can add more things to check (monitors):"
echo "when everything is fine:"
echo "CHECK_vm|"
echo "CHECK_oops|"
echo "on breakdown:"
echo "CHECK_vm|1"
echo "CHECK_oops|1"
echo "for exemple:"
echo "# $DIR_SCRIPTS_MIN/"
echo ""
echo "Sending all informations:"


# Local variables:
# page-delimiter: "^# *\f"
# sh-basic-offset: 4
# End: